C29H26F8N2O3 — CID 59458372
1-cyclopentyl-3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethoxy)phenyl]ethyl]urea (PubChem CID 59458372) has the molecular formula C29H26F8N2O3 and a molecular weight of 602.52 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethoxy)phenyl]ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 59458372 |
| Molecular Formula | C29H26F8N2O3 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 1-cyclopentyl-3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethoxy)phenyl]ethyl]urea |
| SMILES | O=C(NC1CCCC1)N[C@](Cc1ccccc1)(c1ccc(OC(F)(F)F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C29H26F8N2O3/c30-21-14-20(15-24(16-21)41-28(33,34)25(31)32)27(17-18-6-2-1-3-7-18,39-26(40)38-22-8-4-5-9-22)19-10-12-23(13-11-19)42-29(35,36)37/h1-3,6-7,10-16,22,25H,4-5,8-9,17H2,(H2,38,39,40)/t27-/m1/s1 |
| InChIKey | RRIOYZYQOPTCEY-HHHXNRCGSA-N |
| XLogP | 7.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|