C28H24F6N2O3 — CID 74065195
1-[1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-formylcyclobutyl)urea (PubChem CID 74065195) has the molecular formula C28H24F6N2O3 and a molecular weight of 550.50 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-formylcyclobutyl)urea.
| Compound Name | 1-[1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-formylcyclobutyl)urea |
|---|---|
| PubChem CID | 74065195 |
| Molecular Formula | C28H24F6N2O3 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3-formylcyclobutyl)urea |
| SMILES | O=CC1CC(NC(=O)NC(Cc2ccccc2)(c2ccc(F)cc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)C1 |
| InChI | InChI=1S/C28H24F6N2O3/c29-21-8-6-19(7-9-21)27(15-17-4-2-1-3-5-17,36-26(38)35-23-10-18(11-23)16-37)20-12-22(30)14-24(13-20)39-28(33,34)25(31)32/h1-9,12-14,16,18,23,25H,10-11,15H2,(H2,35,36,38) |
| InChIKey | VPWJMYQMUNZZGP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|