C28H26BrF5N2O2 — CID 59459456
1-[(1S)-1-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea (PubChem CID 59459456) has the molecular formula C28H26BrF5N2O2 and a molecular weight of 597.42 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea.
| Compound Name | 1-[(1S)-1-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 59459456 |
| Molecular Formula | C28H26BrF5N2O2 |
| Molecular Weight | 597.42 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | 1-[(1S)-1-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-cyclopentylurea |
| SMILES | O=C(NC1CCCC1)N[C@@](Cc1ccccc1)(c1ccc(Br)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C28H26BrF5N2O2/c29-21-12-10-19(11-13-21)27(17-18-6-2-1-3-7-18,36-26(37)35-23-8-4-5-9-23)20-14-22(30)16-24(15-20)38-28(33,34)25(31)32/h1-3,6-7,10-16,23,25H,4-5,8-9,17H2,(H2,35,36,37)/t27-/m0/s1 |
| InChIKey | WMTRTGXMJFXLSR-MHZLTWQESA-N |
| XLogP | 7.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.42 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|