C28H27F5IN3O3 — CID 89353796
1-[(1S)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-2-hydroxycyclopentyl]urea (PubChem CID 89353796) has the molecular formula C28H27F5IN3O3 and a molecular weight of 675.44 g/mol. Its IUPAC name is 1-[(1S)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-2-hydroxycyclopentyl]urea.
| Compound Name | 1-[(1S)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-2-hydroxycyclopentyl]urea |
|---|---|
| PubChem CID | 89353796 |
| Molecular Formula | C28H27F5IN3O3 |
| Molecular Weight | 675.44 g/mol |
| Exact Mass | 675.10 |
| IUPAC Name | 1-[(1S)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-2-hydroxycyclopentyl]urea |
| SMILES | O=C(NC1CCC[C@H]1O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C28H27F5IN3O3/c29-20-11-19(12-21(13-20)40-28(32,33)25(30)31)27(14-17-5-2-1-3-6-17,24-10-9-18(15-34)16-35-24)37-26(39)36-22-7-4-8-23(22)38/h1-3,5-6,9-13,16,22-23,25,38H,4,7-8,14-15H2,(H2,36,37,39)/t22?,23-,27+/m1/s1 |
| InChIKey | VDZJACBKCGSSNA-ODWFZDEGSA-N |
| XLogP | 6.09 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|