C29H26F8N2O2 — CID 59458365
1-cyclopentyl-3-[1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 59458365) has the molecular formula C29H26F8N2O2 and a molecular weight of 586.52 g/mol. Its IUPAC name is 1-cyclopentyl-3-[1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-cyclopentyl-3-[1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 59458365 |
| Molecular Formula | C29H26F8N2O2 |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 1-cyclopentyl-3-[1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(NC1CCCC1)NC(Cc1ccccc1)(c1ccc(C(F)(F)F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C29H26F8N2O2/c30-22-14-21(15-24(16-22)41-29(36,37)25(31)32)27(17-18-6-2-1-3-7-18,39-26(40)38-23-8-4-5-9-23)19-10-12-20(13-11-19)28(33,34)35/h1-3,6-7,10-16,23,25H,4-5,8-9,17H2,(H2,38,39,40) |
| InChIKey | ZJNWSOKNHACXBM-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|