C26H21F9N2O2 — CID 59458766
1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]urea (PubChem CID 59458766) has the molecular formula C26H21F9N2O2 and a molecular weight of 564.45 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]urea |
|---|---|
| PubChem CID | 59458766 |
| Molecular Formula | C26H21F9N2O2 |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-[(2R)-1,1,1-trifluoropropan-2-yl]urea |
| SMILES | C[C@@H](NC(=O)N[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C26H21F9N2O2/c1-15(25(31,32)33)36-23(38)37-24(14-16-5-3-2-4-6-16,17-7-9-19(27)10-8-17)18-11-20(28)13-21(12-18)39-26(34,35)22(29)30/h2-13,15,22H,14H2,1H3,(H2,36,37,38)/t15-,24-/m1/s1 |
| InChIKey | POZPLFYQNUSGIY-OYLFLEFRSA-N |
| XLogP | 6.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|