C29H24F6N2O2 — CID 89018953
1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1-prop-2-ynylcyclopropyl)urea (PubChem CID 89018953) has the molecular formula C29H24F6N2O2 and a molecular weight of 546.51 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1-prop-2-ynylcyclopropyl)urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1-prop-2-ynylcyclopropyl)urea |
|---|---|
| PubChem CID | 89018953 |
| Molecular Formula | C29H24F6N2O2 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(1-prop-2-ynylcyclopropyl)urea |
| SMILES | C#CCC1(NC(=O)N[C@](Cc2ccccc2)(c2ccc(F)cc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)CC1 |
| InChI | InChI=1S/C29H24F6N2O2/c1-2-12-27(13-14-27)36-26(38)37-28(18-19-6-4-3-5-7-19,20-8-10-22(30)11-9-20)21-15-23(31)17-24(16-21)39-29(34,35)25(32)33/h1,3-11,15-17,25H,12-14,18H2,(H2,36,37,38)/t28-/m1/s1 |
| InChIKey | AQSVGQSOABNIDY-MUUNZHRXSA-N |
| XLogP | 6.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|