C25H19F9N2O3 — CID 59459370
1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(4-hydroxyphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 59459370) has the molecular formula C25H19F9N2O3 and a molecular weight of 566.42 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(4-hydroxyphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(4-hydroxyphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 59459370 |
| Molecular Formula | C25H19F9N2O3 |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(4-hydroxyphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)N[C@](Cc1ccc(O)cc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C25H19F9N2O3/c26-17-5-3-15(4-6-17)23(12-14-1-7-19(37)8-2-14,36-22(38)35-13-24(30,31)32)16-9-18(27)11-20(10-16)39-25(33,34)21(28)29/h1-11,21,37H,12-13H2,(H2,35,36,38)/t23-/m1/s1 |
| InChIKey | AXHMURWMVIZXSP-HSZRJFAPSA-N |
| XLogP | 6.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|