C27H20F12N2O4 — CID 58898107
1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 58898107) has the molecular formula C27H20F12N2O4 and a molecular weight of 664.44 g/mol. Its IUPAC name is 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 58898107 |
| Molecular Formula | C27H20F12N2O4 |
| Molecular Weight | 664.44 g/mol |
| Exact Mass | 664.12 |
| IUPAC Name | 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(1,1,2,2-tetrafluoro-2-hydroxyethoxy)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)N[C@](Cc1ccccc1)(c1ccc(OC(F)(F)C(O)(F)F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H20F12N2O4/c28-18-10-17(11-20(12-18)44-25(34,35)21(29)30)23(13-15-4-2-1-3-5-15,41-22(42)40-14-24(31,32)33)16-6-8-19(9-7-16)45-27(38,39)26(36,37)43/h1-12,21,43H,13-14H2,(H2,40,41,42)/t23-/m1/s1 |
| InChIKey | OHOGTLNWGRUPAQ-HSZRJFAPSA-N |
| XLogP | 6.97 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|