C34H36F8N2O4 — CID 59459039
ethyl 7-[3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]heptanoate (PubChem CID 59459039) has the molecular formula C34H36F8N2O4 and a molecular weight of 688.66 g/mol. Its IUPAC name is ethyl 7-[3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]heptanoate.
| Compound Name | ethyl 7-[3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]heptanoate |
|---|---|
| PubChem CID | 59459039 |
| Molecular Formula | C34H36F8N2O4 |
| Molecular Weight | 688.66 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | ethyl 7-[3-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]heptanoate |
| SMILES | CCOC(=O)CCCCCCc1cccc([C@@](Cc2ccccc2)(NC(=O)NCC(F)(F)F)c2cc(F)cc(OC(F)(F)C(F)F)c2)c1 |
| InChI | InChI=1S/C34H36F8N2O4/c1-2-47-29(45)16-9-4-3-6-11-23-14-10-15-25(17-23)32(21-24-12-7-5-8-13-24,44-31(46)43-22-33(38,39)40)26-18-27(35)20-28(19-26)48-34(41,42)30(36)37/h5,7-8,10,12-15,17-20,30H,2-4,6,9,11,16,21-22H2,1H3,(H2,43,44,46)/t32-/m1/s1 |
| InChIKey | DIZBTZFWIREWNW-JGCGQSQUSA-N |
| XLogP | 8.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.66 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|