C32H28F12N2O4 — CID 59459505
ethyl 4-[4-[(2R)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]butanoate (PubChem CID 59459505) has the molecular formula C32H28F12N2O4 and a molecular weight of 732.56 g/mol. Its IUPAC name is ethyl 4-[4-[(2R)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]butanoate.
| Compound Name | ethyl 4-[4-[(2R)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]butanoate |
|---|---|
| PubChem CID | 59459505 |
| Molecular Formula | C32H28F12N2O4 |
| Molecular Weight | 732.56 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | ethyl 4-[4-[(2R)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(C[C@](NC(=O)NCC(F)(F)F)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C32H28F12N2O4/c1-2-49-26(47)5-3-4-18-6-8-19(9-7-18)16-29(46-28(48)45-17-30(37,38)39,20-10-11-25(34)24(14-20)31(40,41)42)21-12-22(33)15-23(13-21)50-32(43,44)27(35)36/h6-15,27H,2-5,16-17H2,1H3,(H2,45,46,48)/t29-/m1/s1 |
| InChIKey | JWALMOSIWLGANQ-GDLZYMKVSA-N |
| XLogP | 8.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.56 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|