C27H19F12NO2 — CID 59459271
4,4,4-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]butanamide (PubChem CID 59459271) has the molecular formula C27H19F12NO2 and a molecular weight of 617.43 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]butanamide |
|---|---|
| PubChem CID | 59459271 |
| Molecular Formula | C27H19F12NO2 |
| Molecular Weight | 617.43 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | 4,4,4-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]butanamide |
| SMILES | O=C(CCC(F)(F)F)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H19F12NO2/c28-18-10-17(11-19(13-18)42-27(38,39)23(30)31)24(14-15-4-2-1-3-5-15,40-22(41)8-9-25(32,33)34)16-6-7-21(29)20(12-16)26(35,36)37/h1-7,10-13,23H,8-9,14H2,(H,40,41)/t24-/m1/s1 |
| InChIKey | KXFVUHMHRXZDGF-XMMPIXPASA-N |
| XLogP | 8.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.43 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|