C35H27F10NO5 — CID 59541204
5-[2-fluoro-5-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2-phenylethyl]phenoxy]pentanoic acid (PubChem CID 59541204) has the molecular formula C35H27F10NO5 and a molecular weight of 731.58 g/mol. Its IUPAC name is 5-[2-fluoro-5-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2-phenylethyl]phenoxy]pentanoic acid.
| Compound Name | 5-[2-fluoro-5-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2-phenylethyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 59541204 |
| Molecular Formula | C35H27F10NO5 |
| Molecular Weight | 731.58 g/mol |
| Exact Mass | 731.17 |
| IUPAC Name | 5-[2-fluoro-5-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]-2-phenylethyl]phenoxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1cc([C@@](Cc2ccccc2)(NC(=O)c2ccc(F)c(C(F)(F)F)c2)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C35H27F10NO5/c36-24-15-23(16-25(18-24)51-35(44,45)32(39)40)33(19-20-6-2-1-3-7-20,46-31(49)21-9-11-27(37)26(14-21)34(41,42)43)22-10-12-28(38)29(17-22)50-13-5-4-8-30(47)48/h1-3,6-7,9-12,14-18,32H,4-5,8,13,19H2,(H,46,49)(H,47,48)/t33-/m1/s1 |
| InChIKey | HRPOVRWILSRRTL-MGBGTMOVSA-N |
| XLogP | 8.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.58 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|