C36H28F10O5 — CID 159159983
5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]pentanoic acid (PubChem CID 159159983) has the molecular formula C36H28F10O5 and a molecular weight of 730.59 g/mol. Its IUPAC name is 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]pentanoic acid.
| Compound Name | 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 159159983 |
| Molecular Formula | C36H28F10O5 |
| Molecular Weight | 730.59 g/mol |
| Exact Mass | 730.18 |
| IUPAC Name | 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-[4-fluoro-3-(trifluoromethyl)phenyl]-4-oxobutyl]phenoxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc(C[C@@](CC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2ccc(F)cc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)cc1 |
| InChI | InChI=1S/C36H28F10O5/c37-25-9-7-23(8-10-25)34(20-31(47)22-6-13-30(39)29(15-22)35(42,43)44,24-16-26(38)18-28(17-24)51-36(45,46)33(40)41)19-21-4-11-27(12-5-21)50-14-2-1-3-32(48)49/h4-13,15-18,33H,1-3,14,19-20H2,(H,48,49)/t34-/m1/s1 |
| InChIKey | KKJDWMCCVPDKFH-UUWRZZSWSA-N |
| XLogP | 9.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.59 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|