C31H29F9N2O5 — CID 59459276
methyl 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenoxy]pentanoate (PubChem CID 59459276) has the molecular formula C31H29F9N2O5 and a molecular weight of 680.56 g/mol. Its IUPAC name is methyl 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenoxy]pentanoate.
| Compound Name | methyl 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 59459276 |
| Molecular Formula | C31H29F9N2O5 |
| Molecular Weight | 680.56 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | methyl 5-[4-[(2R)-2-(4-fluorophenyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenoxy]pentanoate |
| SMILES | COC(=O)CCCCOc1ccc(C[C@@](NC(=O)NCC(F)(F)F)(c2ccc(F)cc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)cc1 |
| InChI | InChI=1S/C31H29F9N2O5/c1-45-26(43)4-2-3-13-46-24-11-5-19(6-12-24)17-29(20-7-9-22(32)10-8-20,42-28(44)41-18-30(36,37)38)21-14-23(33)16-25(15-21)47-31(39,40)27(34)35/h5-12,14-16,27H,2-4,13,17-18H2,1H3,(H2,41,42,44)/t29-/m1/s1 |
| InChIKey | GLRXBEYNNAJPOZ-GDLZYMKVSA-N |
| XLogP | 7.27 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|