C23H18F9N3O3 — CID 59458509
1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 59458509) has the molecular formula C23H18F9N3O3 and a molecular weight of 555.40 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 59458509 |
| Molecular Formula | C23H18F9N3O3 |
| Molecular Weight | 555.40 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-(3-methyl-1,2-oxazol-5-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1cc(C[C@@](NC(=O)NCC(F)(F)F)(c2ccc(F)cc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)on1 |
| InChI | InChI=1S/C23H18F9N3O3/c1-12-6-18(38-35-12)10-21(13-2-4-15(24)5-3-13,34-20(36)33-11-22(28,29)30)14-7-16(25)9-17(8-14)37-23(31,32)19(26)27/h2-9,19H,10-11H2,1H3,(H2,33,34,36)/t21-/m1/s1 |
| InChIKey | RFVUTJXNEVVMIF-OAQYLSRUSA-N |
| XLogP | 5.85 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|