C26H21F9N2O3 — CID 59458957
1-[(1R)-1-(4-fluoro-3-methoxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 59458957) has the molecular formula C26H21F9N2O3 and a molecular weight of 580.45 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluoro-3-methoxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1R)-1-(4-fluoro-3-methoxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 59458957 |
| Molecular Formula | C26H21F9N2O3 |
| Molecular Weight | 580.45 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 1-[(1R)-1-(4-fluoro-3-methoxyphenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COc1cc([C@@](Cc2ccccc2)(NC(=O)NCC(F)(F)F)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C26H21F9N2O3/c1-39-21-11-16(7-8-20(21)28)24(13-15-5-3-2-4-6-15,37-23(38)36-14-25(31,32)33)17-9-18(27)12-19(10-17)40-26(34,35)22(29)30/h2-12,22H,13-14H2,1H3,(H2,36,37,38)/t24-/m1/s1 |
| InChIKey | FDSCWOPXIYVOPK-XMMPIXPASA-N |
| XLogP | 6.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|