C28H22F12N2O3 — CID 87152349
1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(4,4,4-trifluoro-3-hydroxybutyl)urea (PubChem CID 87152349) has the molecular formula C28H22F12N2O3 and a molecular weight of 662.47 g/mol. Its IUPAC name is 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(4,4,4-trifluoro-3-hydroxybutyl)urea.
| Compound Name | 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(4,4,4-trifluoro-3-hydroxybutyl)urea |
|---|---|
| PubChem CID | 87152349 |
| Molecular Formula | C28H22F12N2O3 |
| Molecular Weight | 662.47 g/mol |
| Exact Mass | 662.14 |
| IUPAC Name | 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(4,4,4-trifluoro-3-hydroxybutyl)urea |
| SMILES | O=C(NCCC(O)C(F)(F)F)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H22F12N2O3/c29-18-10-17(11-19(13-18)45-28(39,40)23(31)32)25(14-15-4-2-1-3-5-15,16-6-7-21(30)20(12-16)26(33,34)35)42-24(44)41-9-8-22(43)27(36,37)38/h1-7,10-13,22-23,43H,8-9,14H2,(H2,41,42,44)/t22?,25-/m1/s1 |
| InChIKey | JSFPOXATHSZWOA-NRWPOFLRSA-N |
| XLogP | 7.32 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.47 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|