C29H24F12N2O2 — CID 87152018
1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(1,1,1-trifluoro-3-methylbutan-2-yl)urea (PubChem CID 87152018) has the molecular formula C29H24F12N2O2 and a molecular weight of 660.50 g/mol. Its IUPAC name is 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(1,1,1-trifluoro-3-methylbutan-2-yl)urea.
| Compound Name | 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(1,1,1-trifluoro-3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 87152018 |
| Molecular Formula | C29H24F12N2O2 |
| Molecular Weight | 660.50 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 1-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(1,1,1-trifluoro-3-methylbutan-2-yl)urea |
| SMILES | CC(C)C(NC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(F)c(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C29H24F12N2O2/c1-15(2)23(28(37,38)39)42-25(44)43-26(14-16-6-4-3-5-7-16,17-8-9-22(31)21(12-17)27(34,35)36)18-10-19(30)13-20(11-18)45-29(40,41)24(32)33/h3-13,15,23-24H,14H2,1-2H3,(H2,42,43,44)/t23?,26-/m1/s1 |
| InChIKey | IMDQYSSMXPWZIA-ANWICMFUSA-N |
| XLogP | 8.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.50 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|