C26H17BrF12N2O2 — CID 59458663
1-[(1R)-2-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 59458663) has the molecular formula C26H17BrF12N2O2 and a molecular weight of 697.31 g/mol. Its IUPAC name is 1-[(1R)-2-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(1R)-2-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 59458663 |
| Molecular Formula | C26H17BrF12N2O2 |
| Molecular Weight | 697.31 g/mol |
| Exact Mass | 696.03 |
| IUPAC Name | 1-[(1R)-2-(4-bromophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)N[C@@](Cc1ccc(Br)cc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H17BrF12N2O2/c27-16-4-1-13(2-5-16)11-23(41-22(42)40-12-24(32,33)34,14-3-6-20(29)19(9-14)25(35,36)37)15-7-17(28)10-18(8-15)43-26(38,39)21(30)31/h1-10,21H,11-12H2,(H2,40,41,42)/t23-/m1/s1 |
| InChIKey | QZWUVZWVVUWSCK-HSZRJFAPSA-N |
| XLogP | 8.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.31 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|