C25H21F8N3O2 — CID 89019011
1-(2-amino-2,2-difluoroethyl)-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea (PubChem CID 89019011) has the molecular formula C25H21F8N3O2 and a molecular weight of 547.45 g/mol. Its IUPAC name is 1-(2-amino-2,2-difluoroethyl)-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea.
| Compound Name | 1-(2-amino-2,2-difluoroethyl)-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 89019011 |
| Molecular Formula | C25H21F8N3O2 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 1-(2-amino-2,2-difluoroethyl)-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea |
| SMILES | NC(F)(F)CNC(=O)N[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C25H21F8N3O2/c26-18-8-6-16(7-9-18)23(13-15-4-2-1-3-5-15,36-22(37)35-14-24(30,31)34)17-10-19(27)12-20(11-17)38-25(32,33)21(28)29/h1-12,21H,13-14,34H2,(H2,35,36,37)/t23-/m1/s1 |
| InChIKey | JKHOEZUJSFTZLP-HSZRJFAPSA-N |
| XLogP | 5.54 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|