C29H27F7N2O2 — CID 162604503
1-[[(1S,2S)-2-fluorocyclopentyl]methyl]-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea (PubChem CID 162604503) has the molecular formula C29H27F7N2O2 and a molecular weight of 568.53 g/mol. Its IUPAC name is 1-[[(1S,2S)-2-fluorocyclopentyl]methyl]-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea.
| Compound Name | 1-[[(1S,2S)-2-fluorocyclopentyl]methyl]-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 162604503 |
| Molecular Formula | C29H27F7N2O2 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 1-[[(1S,2S)-2-fluorocyclopentyl]methyl]-3-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]urea |
| SMILES | O=C(NC[C@@H]1CCC[C@@H]1F)N[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C29H27F7N2O2/c30-22-11-9-20(10-12-22)28(16-18-5-2-1-3-6-18,38-27(39)37-17-19-7-4-8-25(19)32)21-13-23(31)15-24(14-21)40-29(35,36)26(33)34/h1-3,5-6,9-15,19,25-26H,4,7-8,16-17H2,(H2,37,38,39)/t19-,25-,28+/m0/s1 |
| InChIKey | RGBXXXWXGBAHII-VRKFOXNMSA-N |
| XLogP | 7.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|