C26H23F6NO3 — CID 59458403
N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-hydroxybutanamide (PubChem CID 59458403) has the molecular formula C26H23F6NO3 and a molecular weight of 511.46 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-hydroxybutanamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 59458403 |
| Molecular Formula | C26H23F6NO3 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-hydroxybutanamide |
| SMILES | CC(O)CC(=O)N[C@](Cc1ccccc1)(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C26H23F6NO3/c1-16(34)11-23(35)33-25(15-17-5-3-2-4-6-17,18-7-9-20(27)10-8-18)19-12-21(28)14-22(13-19)36-26(31,32)24(29)30/h2-10,12-14,16,24,34H,11,15H2,1H3,(H,33,35)/t16?,25-/m1/s1 |
| InChIKey | TYLHHWKOBUZDNW-ZRSRXRGLSA-N |
| XLogP | 5.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|