C28H22F11NO2 — CID 59459474
5,5,5-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]pentanamide (PubChem CID 59459474) has the molecular formula C28H22F11NO2 and a molecular weight of 613.47 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]pentanamide.
| Compound Name | 5,5,5-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 59459474 |
| Molecular Formula | C28H22F11NO2 |
| Molecular Weight | 613.47 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | 5,5,5-trifluoro-N-[(1R)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenyl-1-[4-(trifluoromethyl)phenyl]ethyl]pentanamide |
| SMILES | O=C(CCCC(F)(F)F)N[C@](Cc1ccccc1)(c1ccc(C(F)(F)F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C28H22F11NO2/c29-21-13-20(14-22(15-21)42-28(38,39)24(30)31)25(16-17-5-2-1-3-6-17,40-23(41)7-4-12-26(32,33)34)18-8-10-19(11-9-18)27(35,36)37/h1-3,5-6,8-11,13-15,24H,4,7,12,16H2,(H,40,41)/t25-/m1/s1 |
| InChIKey | GXSYALSMMGIPRU-RUZDIDTESA-N |
| XLogP | 8.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.47 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|