C32H33F7N2O3 — CID 59459466
ethyl 6-[3-[(1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]hexanoate (PubChem CID 59459466) has the molecular formula C32H33F7N2O3 and a molecular weight of 626.61 g/mol. Its IUPAC name is ethyl 6-[3-[(1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]hexanoate.
| Compound Name | ethyl 6-[3-[(1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]hexanoate |
|---|---|
| PubChem CID | 59459466 |
| Molecular Formula | C32H33F7N2O3 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | ethyl 6-[3-[(1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenyl-1-(2,2,2-trifluoroethylcarbamoylamino)ethyl]phenyl]hexanoate |
| SMILES | CCOC(=O)CCCCCc1cccc([C@@](Cc2ccccc2)(NC(=O)NCC(F)(F)F)c2cc(F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C32H33F7N2O3/c1-2-44-28(42)15-8-4-5-10-22-13-9-14-24(16-22)30(20-23-11-6-3-7-12-23,41-29(43)40-21-31(34,35)36)25-17-26(32(37,38)39)19-27(33)18-25/h3,6-7,9,11-14,16-19H,2,4-5,8,10,15,20-21H2,1H3,(H2,40,41,43)/t30-/m1/s1 |
| InChIKey | BMOJXWBNUVEIGT-SSEXGKCCSA-N |
| XLogP | 7.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|