C29H19F8NO — CID 59459335
2,3-difluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 59459335) has the molecular formula C29H19F8NO and a molecular weight of 549.46 g/mol. Its IUPAC name is 2,3-difluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 2,3-difluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 59459335 |
| Molecular Formula | C29H19F8NO |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2,3-difluoro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C29H19F8NO/c30-24-14-6-13-23(25(24)31)26(39)38-27(17-18-7-2-1-3-8-18,19-9-4-11-21(15-19)28(32,33)34)20-10-5-12-22(16-20)29(35,36)37/h1-16H,17H2,(H,38,39) |
| InChIKey | SKVSCKKTMQADID-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |