C28H27F5INO — CID 162553639
N-[1-[3-[difluoro(iodo)methyl]phenyl]-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3,3-dimethylbutanamide (PubChem CID 162553639) has the molecular formula C28H27F5INO and a molecular weight of 615.42 g/mol. Its IUPAC name is N-[1-[3-[difluoro(iodo)methyl]phenyl]-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[1-[3-[difluoro(iodo)methyl]phenyl]-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 162553639 |
| Molecular Formula | C28H27F5INO |
| Molecular Weight | 615.42 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | N-[1-[3-[difluoro(iodo)methyl]phenyl]-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)I)c1 |
| InChI | InChI=1S/C28H27F5INO/c1-25(2,3)18-24(36)35-26(17-19-9-5-4-6-10-19,20-11-7-13-22(15-20)27(29,30)31)21-12-8-14-23(16-21)28(32,33)34/h4-16H,17-18H2,1-3H3,(H,35,36) |
| InChIKey | ALSHKXBJQRCQML-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.42 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|