C27H27F3N2O — CID 58921043
2-cyclopentyl-N-[2-phenyl-1-pyridin-2-yl-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 58921043) has the molecular formula C27H27F3N2O and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-phenyl-1-pyridin-2-yl-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-phenyl-1-pyridin-2-yl-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 58921043 |
| Molecular Formula | C27H27F3N2O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-cyclopentyl-N-[2-phenyl-1-pyridin-2-yl-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | O=C(CC1CCCC1)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1ccccn1 |
| InChI | InChI=1S/C27H27F3N2O/c28-27(29,30)23-14-8-13-22(18-23)26(24-15-6-7-16-31-24,19-21-11-2-1-3-12-21)32-25(33)17-20-9-4-5-10-20/h1-3,6-8,11-16,18,20H,4-5,9-10,17,19H2,(H,32,33) |
| InChIKey | UKCKAVFOKPINMS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |