C28H25F2N3O — CID 58920992
1-[3-(1,1-difluoroethyl)phenyl]-3-(1,2-diphenyl-1-pyridin-2-ylethyl)urea (PubChem CID 58920992) has the molecular formula C28H25F2N3O and a molecular weight of 457.52 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethyl)phenyl]-3-(1,2-diphenyl-1-pyridin-2-ylethyl)urea.
| Compound Name | 1-[3-(1,1-difluoroethyl)phenyl]-3-(1,2-diphenyl-1-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 58920992 |
| Molecular Formula | C28H25F2N3O |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-[3-(1,1-difluoroethyl)phenyl]-3-(1,2-diphenyl-1-pyridin-2-ylethyl)urea |
| SMILES | CC(F)(F)c1cccc(NC(=O)NC(Cc2ccccc2)(c2ccccc2)c2ccccn2)c1 |
| InChI | InChI=1S/C28H25F2N3O/c1-27(29,30)23-15-10-16-24(19-23)32-26(34)33-28(22-13-6-3-7-14-22,25-17-8-9-18-31-25)20-21-11-4-2-5-12-21/h2-19H,20H2,1H3,(H2,32,33,34) |
| InChIKey | SOODORXPDZOHTK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |