C26H28F2N2 — CID 143473044
1-[3-[cyclopentyl(difluoro)methyl]phenyl]-N-methyl-2-phenyl-1-pyridin-2-ylethanamine (PubChem CID 143473044) has the molecular formula C26H28F2N2 and a molecular weight of 406.52 g/mol. Its IUPAC name is 1-[3-[cyclopentyl(difluoro)methyl]phenyl]-N-methyl-2-phenyl-1-pyridin-2-ylethanamine.
| Compound Name | 1-[3-[cyclopentyl(difluoro)methyl]phenyl]-N-methyl-2-phenyl-1-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 143473044 |
| Molecular Formula | C26H28F2N2 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 1-[3-[cyclopentyl(difluoro)methyl]phenyl]-N-methyl-2-phenyl-1-pyridin-2-ylethanamine |
| SMILES | CNC(Cc1ccccc1)(c1cccc(C(F)(F)C2CCCC2)c1)c1ccccn1 |
| InChI | InChI=1S/C26H28F2N2/c1-29-25(24-16-7-8-17-30-24,19-20-10-3-2-4-11-20)22-14-9-15-23(18-22)26(27,28)21-12-5-6-13-21/h2-4,7-11,14-18,21,29H,5-6,12-13,19H2,1H3 |
| InChIKey | ONYRUFFHRAWWSG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |