C30H22F6N2O3 — CID 59458519
4-methyl-3-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 59458519) has the molecular formula C30H22F6N2O3 and a molecular weight of 572.51 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 59458519 |
| Molecular Formula | C30H22F6N2O3 |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 4-methyl-3-nitro-N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(Cc2ccccc2)(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H22F6N2O3/c1-19-13-14-21(15-26(19)38(40)41)27(39)37-28(18-20-7-3-2-4-8-20,22-9-5-11-24(16-22)29(31,32)33)23-10-6-12-25(17-23)30(34,35)36/h2-17H,18H2,1H3,(H,37,39) |
| InChIKey | KOTLQWLXQCYAEF-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|