C27H19F6NO2 — CID 59459002
N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-3-carboxamide (PubChem CID 59459002) has the molecular formula C27H19F6NO2 and a molecular weight of 503.44 g/mol. Its IUPAC name is N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 59459002 |
| Molecular Formula | C27H19F6NO2 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]furan-3-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)c1ccoc1 |
| InChI | InChI=1S/C27H19F6NO2/c28-26(29,30)22-10-4-8-20(14-22)25(16-18-6-2-1-3-7-18,34-24(35)19-12-13-36-17-19)21-9-5-11-23(15-21)27(31,32)33/h1-15,17H,16H2,(H,34,35) |
| InChIKey | JICGBVJIQNRJKN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |