C27H19F6NOS — CID 59458588
N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]thiophene-3-carboxamide (PubChem CID 59458588) has the molecular formula C27H19F6NOS and a molecular weight of 519.51 g/mol. Its IUPAC name is N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 59458588 |
| Molecular Formula | C27H19F6NOS |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | N-[2-phenyl-1,1-bis[3-(trifluoromethyl)phenyl]ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C27H19F6NOS/c28-26(29,30)22-10-4-8-20(14-22)25(16-18-6-2-1-3-7-18,34-24(35)19-12-13-36-17-19)21-9-5-11-23(15-21)27(31,32)33/h1-15,17H,16H2,(H,34,35) |
| InChIKey | VZYUAMSORSELMV-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |