C13H10F3NOS — CID 17436374
N-[[3-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxamide (PubChem CID 17436374) has the molecular formula C13H10F3NOS and a molecular weight of 285.29 g/mol. Its IUPAC name is N-[[3-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[3-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17436374 |
| Molecular Formula | C13H10F3NOS |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-[[3-(trifluoromethyl)phenyl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C13H10F3NOS/c14-13(15,16)11-3-1-2-9(6-11)7-17-12(18)10-4-5-19-8-10/h1-6,8H,7H2,(H,17,18) |
| InChIKey | WONXKBXWJLPRHN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |