C18H13F3N4O — CID 74246545
2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carboxamide (PubChem CID 74246545) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 74246545 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1cnc(-c2ccncc2)nc1 |
| InChI | InChI=1S/C18H13F3N4O/c19-18(20,21)15-3-1-2-12(8-15)9-25-17(26)14-10-23-16(24-11-14)13-4-6-22-7-5-13/h1-8,10-11H,9H2,(H,25,26) |
| InChIKey | SJXYUUGEMNUMHD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |