C23H16F3N3O — CID 42749444
2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide (PubChem CID 42749444) has the molecular formula C23H16F3N3O and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide.
| Compound Name | 2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42749444 |
| Molecular Formula | C23H16F3N3O |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-pyridin-4-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C23H16F3N3O/c24-23(25,26)17-5-3-4-15(12-17)14-28-22(30)19-13-21(16-8-10-27-11-9-16)29-20-7-2-1-6-18(19)20/h1-13H,14H2,(H,28,30) |
| InChIKey | KBQZDMVZXHHZAY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |