C25H19F3N2O2 — CID 42749577
2-(3-methoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide (PubChem CID 42749577) has the molecular formula C25H19F3N2O2 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42749577 |
| Molecular Formula | C25H19F3N2O2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]quinoline-4-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCc3cccc(C(F)(F)F)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H19F3N2O2/c1-32-19-9-5-7-17(13-19)23-14-21(20-10-2-3-11-22(20)30-23)24(31)29-15-16-6-4-8-18(12-16)25(26,27)28/h2-14H,15H2,1H3,(H,29,31) |
| InChIKey | WRLOKODVLSPMMH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |