C31H26N2O2 — CID 42749565
N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 42749565) has the molecular formula C31H26N2O2 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42749565 |
| Molecular Formula | C31H26N2O2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-(1,2-diphenylethyl)-2-(3-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NC(Cc3ccccc3)c3ccccc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C31H26N2O2/c1-35-25-16-10-15-24(20-25)30-21-27(26-17-8-9-18-28(26)32-30)31(34)33-29(23-13-6-3-7-14-23)19-22-11-4-2-5-12-22/h2-18,20-21,29H,19H2,1H3,(H,33,34) |
| InChIKey | QLFMMTDVSPUAFN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |