C26H24N2O2 — CID 4673574
2-(3-methoxyphenyl)-N-(2,4,6-trimethylphenyl)quinoline-4-carboxamide (PubChem CID 4673574) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-(2,4,6-trimethylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(3-methoxyphenyl)-N-(2,4,6-trimethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4673574 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-(2,4,6-trimethylphenyl)quinoline-4-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3c(C)cc(C)cc3C)c3ccccc3n2)c1 |
| InChI | InChI=1S/C26H24N2O2/c1-16-12-17(2)25(18(3)13-16)28-26(29)22-15-24(19-8-7-9-20(14-19)30-4)27-23-11-6-5-10-21(22)23/h5-15H,1-4H3,(H,28,29) |
| InChIKey | QUOKINRBCIYYSS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |