C27H25N3O2 — CID 26713872
N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-phenylquinoline-4-carboxamide (PubChem CID 26713872) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 26713872 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)c2cc(-c3ccccc3)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C27H25N3O2/c1-17-13-18(2)26(19(3)14-17)30-25(31)16-28-27(32)22-15-24(20-9-5-4-6-10-20)29-23-12-8-7-11-21(22)23/h4-15H,16H2,1-3H3,(H,28,32)(H,30,31) |
| InChIKey | LADLMDAAKYCFEZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |