C21H20ClN3O2 — CID 18283329
2-chloro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]quinoline-4-carboxamide (PubChem CID 18283329) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 2-chloro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-chloro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18283329 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-chloro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)c2cc(Cl)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-12-8-13(2)20(14(3)9-12)25-19(26)11-23-21(27)16-10-18(22)24-17-7-5-4-6-15(16)17/h4-10H,11H2,1-3H3,(H,23,27)(H,25,26) |
| InChIKey | MBAZTUMHQPWEKK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|