C21H19ClN2O3 — CID 118174966
ethyl 4-[(2-chloroquinoline-4-carbonyl)amino]-3,5-dimethylbenzoate (PubChem CID 118174966) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is ethyl 4-[(2-chloroquinoline-4-carbonyl)amino]-3,5-dimethylbenzoate.
| Compound Name | ethyl 4-[(2-chloroquinoline-4-carbonyl)amino]-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 118174966 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl 4-[(2-chloroquinoline-4-carbonyl)amino]-3,5-dimethylbenzoate |
| SMILES | CCOC(=O)c1cc(C)c(NC(=O)c2cc(Cl)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C21H19ClN2O3/c1-4-27-21(26)14-9-12(2)19(13(3)10-14)24-20(25)16-11-18(22)23-17-8-6-5-7-15(16)17/h5-11H,4H2,1-3H3,(H,24,25) |
| InChIKey | BODUJCBQYOZUMN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|