C24H19ClN2O — CID 5128996
2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)quinoline-4-carboxamide (PubChem CID 5128996) has the molecular formula C24H19ClN2O and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5128996 |
| Molecular Formula | C24H19ClN2O |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(2,6-dimethylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C24H19ClN2O/c1-15-8-7-9-16(2)23(15)27-24(28)19-14-22(18-11-3-5-12-20(18)25)26-21-13-6-4-10-17(19)21/h3-14H,1-2H3,(H,27,28) |
| InChIKey | UUNPWHQZNXRAPP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |