C40H36Cl2N4O2 — CID 5201132
2-(2-chlorophenyl)-N-[8-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]octyl]quinoline-4-carboxamide (PubChem CID 5201132) has the molecular formula C40H36Cl2N4O2 and a molecular weight of 675.66 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[8-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]octyl]quinoline-4-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[8-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]octyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5201132 |
| Molecular Formula | C40H36Cl2N4O2 |
| Molecular Weight | 675.66 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[8-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]octyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCCCCCCCNC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C40H36Cl2N4O2/c41-33-19-9-5-17-29(33)37-25-31(27-15-7-11-21-35(27)45-37)39(47)43-23-13-3-1-2-4-14-24-44-40(48)32-26-38(30-18-6-10-20-34(30)42)46-36-22-12-8-16-28(32)36/h5-12,15-22,25-26H,1-4,13-14,23-24H2,(H,43,47)(H,44,48) |
| InChIKey | ROOGVGBSPDDCHZ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.66 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|