C21H19ClN2O3 — CID 30591047
methyl 4-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]butanoate (PubChem CID 30591047) has the molecular formula C21H19ClN2O3 and a molecular weight of 382.85 g/mol. Its IUPAC name is methyl 4-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 30591047 |
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | methyl 4-[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C21H19ClN2O3/c1-27-20(25)11-6-12-23-21(26)16-13-19(15-8-2-4-9-17(15)22)24-18-10-5-3-7-14(16)18/h2-5,7-10,13H,6,11-12H2,1H3,(H,23,26) |
| InChIKey | DJDKYERSCRAQPG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|