C23H17BrN2O3S — CID 22427756
ethyl 4-[[2-(5-bromothiophen-2-yl)quinoline-4-carbonyl]amino]benzoate (PubChem CID 22427756) has the molecular formula C23H17BrN2O3S and a molecular weight of 481.37 g/mol. Its IUPAC name is ethyl 4-[[2-(5-bromothiophen-2-yl)quinoline-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(5-bromothiophen-2-yl)quinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 22427756 |
| Molecular Formula | C23H17BrN2O3S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | ethyl 4-[[2-(5-bromothiophen-2-yl)quinoline-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(-c3ccc(Br)s3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H17BrN2O3S/c1-2-29-23(28)14-7-9-15(10-8-14)25-22(27)17-13-19(20-11-12-21(24)30-20)26-18-6-4-3-5-16(17)18/h3-13H,2H2,1H3,(H,25,27) |
| InChIKey | UVFDRQLYNMMUJZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |