C23H17N3O3 — CID 2220860
methyl 4-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate (PubChem CID 2220860) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl 4-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2220860 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | methyl 4-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(-c3ccccn3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H17N3O3/c1-29-23(28)15-9-11-16(12-10-15)25-22(27)18-14-21(20-8-4-5-13-24-20)26-19-7-3-2-6-17(18)19/h2-14H,1H3,(H,25,27) |
| InChIKey | VFQDDYXCRYCRRK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |