C25H21N3O3 — CID 177319819
methyl 4-[(6,8-dimethyl-2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate (PubChem CID 177319819) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl 4-[(6,8-dimethyl-2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(6,8-dimethyl-2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 177319819 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | methyl 4-[(6,8-dimethyl-2-pyridin-2-ylquinoline-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(-c3ccccn3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C25H21N3O3/c1-15-12-16(2)23-19(13-15)20(14-22(28-23)21-6-4-5-11-26-21)24(29)27-18-9-7-17(8-10-18)25(30)31-3/h4-14H,1-3H3,(H,27,29) |
| InChIKey | FYBKWZADGABMSL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |