C28H28N2O3S — CID 19647693
pentyl 4-[(6,8-dimethyl-2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate (PubChem CID 19647693) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is pentyl 4-[(6,8-dimethyl-2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | pentyl 4-[(6,8-dimethyl-2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 19647693 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | pentyl 4-[(6,8-dimethyl-2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)c2cc(-c3cccs3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C28H28N2O3S/c1-4-5-6-13-33-28(32)20-9-11-21(12-10-20)29-27(31)23-17-24(25-8-7-14-34-25)30-26-19(3)15-18(2)16-22(23)26/h7-12,14-17H,4-6,13H2,1-3H3,(H,29,31) |
| InChIKey | XBHMSMLYQSLZKC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|