C30H30N2O3 — CID 17257826
butyl 4-[[6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate (PubChem CID 17257826) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is butyl 4-[[6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 17257826 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | butyl 4-[[6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cc(-c3ccc(C)cc3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C30H30N2O3/c1-5-6-15-35-30(34)23-11-13-24(14-12-23)31-29(33)26-18-27(22-9-7-19(2)8-10-22)32-28-21(4)16-20(3)17-25(26)28/h7-14,16-18H,5-6,15H2,1-4H3,(H,31,33) |
| InChIKey | XTNRMDSHKTVATK-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|